C7H13BN2O2 — CID 54428300
CID 54428300 (PubChem CID 54428300) has the molecular formula C7H13BN2O2 and a molecular weight of 168.01 g/mol.
| Compound Name | CID 54428300 |
|---|---|
| PubChem CID | 54428300 |
| Molecular Formula | C7H13BN2O2 |
| Molecular Weight | 168.01 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)N(CC=O)CCCN |
| InChI | InChI=1S/C7H13BN2O2/c8-6-7(12)10(4-5-11)3-1-2-9/h5H,1-4,6,9H2 |
| InChIKey | OVGDJQWKZSVXDM-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.01 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|