C11H15NO2 — CID 142046783
1-hydroperoxy-1,2-dimethyl-3,4-dihydroisoquinoline (PubChem CID 142046783) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-hydroperoxy-1,2-dimethyl-3,4-dihydroisoquinoline.
| Compound Name | 1-hydroperoxy-1,2-dimethyl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 142046783 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-hydroperoxy-1,2-dimethyl-3,4-dihydroisoquinoline |
| SMILES | CN1CCc2ccccc2C1(C)OO |
| InChI | InChI=1S/C11H15NO2/c1-11(14-13)10-6-4-3-5-9(10)7-8-12(11)2/h3-6,13H,7-8H2,1-2H3 |
| InChIKey | YQSSWRXMDOIVLN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|