C30H30N6O6S — CID 142047469
3-(4-aminophenyl)propanoic acid;1-(1H-benzimidazol-2-yl)-3-[3-(4-methoxy-3-sulfamoylphenyl)phenyl]urea (PubChem CID 142047469) has the molecular formula C30H30N6O6S and a molecular weight of 602.67 g/mol. Its IUPAC name is 3-(4-aminophenyl)propanoic acid;1-(1H-benzimidazol-2-yl)-3-[3-(4-methoxy-3-sulfamoylphenyl)phenyl]urea.
| Compound Name | 3-(4-aminophenyl)propanoic acid;1-(1H-benzimidazol-2-yl)-3-[3-(4-methoxy-3-sulfamoylphenyl)phenyl]urea |
|---|---|
| PubChem CID | 142047469 |
| Molecular Formula | C30H30N6O6S |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | 3-(4-aminophenyl)propanoic acid;1-(1H-benzimidazol-2-yl)-3-[3-(4-methoxy-3-sulfamoylphenyl)phenyl]urea |
| SMILES | COc1ccc(-c2cccc(NC(=O)Nc3nc4ccccc4[nH]3)c2)cc1S(N)(=O)=O.Nc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C21H19N5O4S.C9H11NO2/c1-30-18-10-9-14(12-19(18)31(22,28)29)13-5-4-6-15(11-13)23-21(27)26-20-24-16-7-2-3-8-17(16)25-20;10-8-4-1-7(2-5-8)3-6-9(11)12/h2-12H,1H3,(H2,22,28,29)(H3,23,24,25,26,27);1-2,4-5H,3,6,10H2,(H,11,12) |
| InChIKey | KOCUIPFPGCGBPH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 202.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|