C19H15N3O2S — CID 52667720
N-(1H-benzimidazol-2-yl)-3-methoxy-5-phenylthiophene-2-carboxamide (PubChem CID 52667720) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-3-methoxy-5-phenylthiophene-2-carboxamide.
| Compound Name | N-(1H-benzimidazol-2-yl)-3-methoxy-5-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 52667720 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-3-methoxy-5-phenylthiophene-2-carboxamide |
| SMILES | COc1cc(-c2ccccc2)sc1C(=O)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H15N3O2S/c1-24-15-11-16(12-7-3-2-4-8-12)25-17(15)18(23)22-19-20-13-9-5-6-10-14(13)21-19/h2-11H,1H3,(H2,20,21,22,23) |
| InChIKey | YXFDPFQLJWAGFC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |