C20H17N3O2S — CID 35808128
N-(1H-benzimidazol-2-yl)-4-(4-methoxyphenyl)-5-methylthiophene-2-carboxamide (PubChem CID 35808128) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-4-(4-methoxyphenyl)-5-methylthiophene-2-carboxamide.
| Compound Name | N-(1H-benzimidazol-2-yl)-4-(4-methoxyphenyl)-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 35808128 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-4-(4-methoxyphenyl)-5-methylthiophene-2-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3nc4ccccc4[nH]3)sc2C)cc1 |
| InChI | InChI=1S/C20H17N3O2S/c1-12-15(13-7-9-14(25-2)10-8-13)11-18(26-12)19(24)23-20-21-16-5-3-4-6-17(16)22-20/h3-11H,1-2H3,(H2,21,22,23,24) |
| InChIKey | HEMXOJAMNHLJHE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |