C21H17N3O3S — CID 167810499
methyl 5-[[4-(1H-benzimidazol-2-yl)phenyl]carbamoyl]-3-methylthiophene-2-carboxylate (PubChem CID 167810499) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is methyl 5-[[4-(1H-benzimidazol-2-yl)phenyl]carbamoyl]-3-methylthiophene-2-carboxylate.
| Compound Name | methyl 5-[[4-(1H-benzimidazol-2-yl)phenyl]carbamoyl]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 167810499 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | methyl 5-[[4-(1H-benzimidazol-2-yl)phenyl]carbamoyl]-3-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(C(=O)Nc2ccc(-c3nc4ccccc4[nH]3)cc2)cc1C |
| InChI | InChI=1S/C21H17N3O3S/c1-12-11-17(28-18(12)21(26)27-2)20(25)22-14-9-7-13(8-10-14)19-23-15-5-3-4-6-16(15)24-19/h3-11H,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | XKQVMIXFLTWGNZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |