C13H10BrN3OS — CID 79934420
N-(1H-benzimidazol-2-yl)-5-bromo-4-methylthiophene-2-carboxamide (PubChem CID 79934420) has the molecular formula C13H10BrN3OS and a molecular weight of 336.21 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-5-bromo-4-methylthiophene-2-carboxamide.
| Compound Name | N-(1H-benzimidazol-2-yl)-5-bromo-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79934420 |
| Molecular Formula | C13H10BrN3OS |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-5-bromo-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nc3ccccc3[nH]2)sc1Br |
| InChI | InChI=1S/C13H10BrN3OS/c1-7-6-10(19-11(7)14)12(18)17-13-15-8-4-2-3-5-9(8)16-13/h2-6H,1H3,(H2,15,16,17,18) |
| InChIKey | UEHQCYAQLIVTLK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |