C29H36O5 — CID 142047524
2-[(3Z)-hexa-1,3,5-trien-2-yl]-6-[(3Z,6Z)-10-methoxy-8-methyl-5-oxo-3-prop-2-enoxydodeca-1,3,6-trien-4-yl]-3-methylpyran-4-one (PubChem CID 142047524) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is 2-[(3Z)-hexa-1,3,5-trien-2-yl]-6-[(3Z,6Z)-10-methoxy-8-methyl-5-oxo-3-prop-2-enoxydodeca-1,3,6-trien-4-yl]-3-methylpyran-4-one.
| Compound Name | 2-[(3Z)-hexa-1,3,5-trien-2-yl]-6-[(3Z,6Z)-10-methoxy-8-methyl-5-oxo-3-prop-2-enoxydodeca-1,3,6-trien-4-yl]-3-methylpyran-4-one |
|---|---|
| PubChem CID | 142047524 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 2-[(3Z)-hexa-1,3,5-trien-2-yl]-6-[(3Z,6Z)-10-methoxy-8-methyl-5-oxo-3-prop-2-enoxydodeca-1,3,6-trien-4-yl]-3-methylpyran-4-one |
| SMILES | C=C/C=C\C(=C)c1oc(/C(C(=O)/C=C\C(C)CC(CC)OC)=C(\C=C)OCC=C)cc(=O)c1C |
| InChI | InChI=1S/C29H36O5/c1-9-13-14-21(6)29-22(7)25(31)19-27(34-29)28(26(12-4)33-17-10-2)24(30)16-15-20(5)18-23(11-3)32-8/h9-10,12-16,19-20,23H,1-2,4,6,11,17-18H2,3,5,7-8H3/b14-13-,16-15-,28-26+ |
| InChIKey | HBYMQOAVNICNTB-TUGUMYOOSA-N |
| XLogP | 6.38 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|