C29H27Cl2CoN3 — CID 142048598
dichlorocobalt;N-(2-ethylphenyl)-1-[6-[(2-ethylphenyl)iminomethyl]-2-pyridinyl]-1-phenylmethanimine (PubChem CID 142048598) has the molecular formula C29H27Cl2CoN3 and a molecular weight of 547.40 g/mol. Its IUPAC name is dichlorocobalt;N-(2-ethylphenyl)-1-[6-[(2-ethylphenyl)iminomethyl]-2-pyridinyl]-1-phenylmethanimine.
| Compound Name | dichlorocobalt;N-(2-ethylphenyl)-1-[6-[(2-ethylphenyl)iminomethyl]-2-pyridinyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 142048598 |
| Molecular Formula | C29H27Cl2CoN3 |
| Molecular Weight | 547.40 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | dichlorocobalt;N-(2-ethylphenyl)-1-[6-[(2-ethylphenyl)iminomethyl]-2-pyridinyl]-1-phenylmethanimine |
| SMILES | CCc1ccccc1/N=C/c1cccc(/C(=N/c2ccccc2CC)c2ccccc2)n1.Cl[Co]Cl |
| InChI | InChI=1S/C29H27N3.2ClH.Co/c1-3-22-13-8-10-18-26(22)30-21-25-17-12-20-28(31-25)29(24-15-6-5-7-16-24)32-27-19-11-9-14-23(27)4-2;;;/h5-21H,3-4H2,1-2H3;2*1H;/q;;;+2/p-2/b30-21+,32-29+;;; |
| InChIKey | FYHSSUVTJKNOQP-NEOCDGLVSA-L |
| XLogP | 8.50 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.40 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|