C14H17BrN2O2 — CID 142049057
(3R)-3-amino-1-[4-bromo-2-[(E)-2-hydroxyprop-1-enyl]-3-methylphenyl]pyrrolidin-2-one (PubChem CID 142049057) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-bromo-2-[(E)-2-hydroxyprop-1-enyl]-3-methylphenyl]pyrrolidin-2-one.
| Compound Name | (3R)-3-amino-1-[4-bromo-2-[(E)-2-hydroxyprop-1-enyl]-3-methylphenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 142049057 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | (3R)-3-amino-1-[4-bromo-2-[(E)-2-hydroxyprop-1-enyl]-3-methylphenyl]pyrrolidin-2-one |
| SMILES | C/C(O)=C\c1c(N2CC[C@@H](N)C2=O)ccc(Br)c1C |
| InChI | InChI=1S/C14H17BrN2O2/c1-8(18)7-10-9(2)11(15)3-4-13(10)17-6-5-12(16)14(17)19/h3-4,7,12,18H,5-6,16H2,1-2H3/b8-7+/t12-/m1/s1 |
| InChIKey | COTYGHIEZNHYEG-ABZNLYFFSA-N |
| XLogP | 2.74 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|