C41H32O3S2 — CID 14204922
1-[4-[(4-tert-butylphenyl)methoxy]phenyl]sulfanyl-5-naphthalen-2-ylsulfanylanthracene-9,10-dione (PubChem CID 14204922) has the molecular formula C41H32O3S2 and a molecular weight of 636.84 g/mol. Its IUPAC name is 1-[4-[(4-tert-butylphenyl)methoxy]phenyl]sulfanyl-5-naphthalen-2-ylsulfanylanthracene-9,10-dione.
| Compound Name | 1-[4-[(4-tert-butylphenyl)methoxy]phenyl]sulfanyl-5-naphthalen-2-ylsulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 14204922 |
| Molecular Formula | C41H32O3S2 |
| Molecular Weight | 636.84 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | 1-[4-[(4-tert-butylphenyl)methoxy]phenyl]sulfanyl-5-naphthalen-2-ylsulfanylanthracene-9,10-dione |
| SMILES | CC(C)(C)c1ccc(COc2ccc(Sc3cccc4c3C(=O)c3cccc(Sc5ccc6ccccc6c5)c3C4=O)cc2)cc1 |
| InChI | InChI=1S/C41H32O3S2/c1-41(2,3)29-17-14-26(15-18-29)25-44-30-19-22-31(23-20-30)45-35-12-6-10-33-37(35)39(42)34-11-7-13-36(38(34)40(33)43)46-32-21-16-27-8-4-5-9-28(27)24-32/h4-24H,25H2,1-3H3 |
| InChIKey | NJTHWFZAPFAUEW-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.84 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|