C31H23F3O3S2 — CID 54238587
1-(4-tert-butylphenyl)sulfanyl-5-[3-(trifluoromethoxy)phenyl]sulfanylanthracene-9,10-dione (PubChem CID 54238587) has the molecular formula C31H23F3O3S2 and a molecular weight of 564.65 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfanyl-5-[3-(trifluoromethoxy)phenyl]sulfanylanthracene-9,10-dione.
| Compound Name | 1-(4-tert-butylphenyl)sulfanyl-5-[3-(trifluoromethoxy)phenyl]sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 54238587 |
| Molecular Formula | C31H23F3O3S2 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfanyl-5-[3-(trifluoromethoxy)phenyl]sulfanylanthracene-9,10-dione |
| SMILES | CC(C)(C)c1ccc(Sc2cccc3c2C(=O)c2cccc(Sc4cccc(OC(F)(F)F)c4)c2C3=O)cc1 |
| InChI | InChI=1S/C31H23F3O3S2/c1-30(2,3)18-13-15-20(16-14-18)38-24-11-5-9-22-26(24)28(35)23-10-6-12-25(27(23)29(22)36)39-21-8-4-7-19(17-21)37-31(32,33)34/h4-17H,1-3H3 |
| InChIKey | QOIWUBBBDNXATF-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|