C33H20F7O2S2+ — CID 58537838
[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanium (PubChem CID 58537838) has the molecular formula C33H20F7O2S2+ and a molecular weight of 645.64 g/mol. Its IUPAC name is [4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanium.
| Compound Name | [4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 58537838 |
| Molecular Formula | C33H20F7O2S2+ |
| Molecular Weight | 645.64 g/mol |
| Exact Mass | 645.08 |
| IUPAC Name | [4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanium |
| SMILES | COc1ccc([S+](c2ccc(Sc3ccccc3C(=O)c3ccccc3)cc2)c2c(F)c(F)c(C(F)(F)F)c(F)c2F)cc1 |
| InChI | InChI=1S/C33H20F7O2S2/c1-42-20-11-15-22(16-12-20)44(32-29(36)27(34)26(33(38,39)40)28(35)30(32)37)23-17-13-21(14-18-23)43-25-10-6-5-9-24(25)31(41)19-7-3-2-4-8-19/h2-18H,1H3/q+1 |
| InChIKey | BNTBNYJVWGYCIO-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.64 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|