C34H26F9O2PS2 — CID 139989836
[[5-[4-[5-methoxy-2-[2-(trifluoromethyl)phenyl]sulfanylphenyl]phenyl]sulfanyl-2-methylphenyl]-phenylmethylidene]oxidanium hexafluorophosphate (PubChem CID 139989836) has the molecular formula C34H26F9O2PS2 and a molecular weight of 732.67 g/mol. Its IUPAC name is [[5-[4-[5-methoxy-2-[2-(trifluoromethyl)phenyl]sulfanylphenyl]phenyl]sulfanyl-2-methylphenyl]-phenylmethylidene]oxidanium hexafluorophosphate.
| Compound Name | [[5-[4-[5-methoxy-2-[2-(trifluoromethyl)phenyl]sulfanylphenyl]phenyl]sulfanyl-2-methylphenyl]-phenylmethylidene]oxidanium hexafluorophosphate |
|---|---|
| PubChem CID | 139989836 |
| Molecular Formula | C34H26F9O2PS2 |
| Molecular Weight | 732.67 g/mol |
| Exact Mass | 732.10 |
| IUPAC Name | [[5-[4-[5-methoxy-2-[2-(trifluoromethyl)phenyl]sulfanylphenyl]phenyl]sulfanyl-2-methylphenyl]-phenylmethylidene]oxidanium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.[H]/[O+]=C(\c1ccccc1)c1cc(Sc2ccc(-c3cc(OC)ccc3Sc3ccccc3C(F)(F)F)cc2)ccc1C |
| InChI | InChI=1S/C34H25F3O2S2.F6P/c1-22-12-16-27(21-28(22)33(38)24-8-4-3-5-9-24)40-26-17-13-23(14-18-26)29-20-25(39-2)15-19-31(29)41-32-11-7-6-10-30(32)34(35,36)37;1-7(2,3,4,5)6/h3-21H,1-2H3;/q;-1/p+1 |
| InChIKey | SESXBDCCOMVBPN-UHFFFAOYSA-O |
| XLogP | 13.32 |
| TPSA | 30.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.67 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|