C33H24F9O2PS2 — CID 139989865
[[3-[4-[5-methoxy-2-[4-(trifluoromethyl)phenyl]sulfanylphenyl]phenyl]sulfanylphenyl]-phenylmethylidene]oxidanium hexafluorophosphate (PubChem CID 139989865) has the molecular formula C33H24F9O2PS2 and a molecular weight of 718.64 g/mol. Its IUPAC name is [[3-[4-[5-methoxy-2-[4-(trifluoromethyl)phenyl]sulfanylphenyl]phenyl]sulfanylphenyl]-phenylmethylidene]oxidanium hexafluorophosphate.
| Compound Name | [[3-[4-[5-methoxy-2-[4-(trifluoromethyl)phenyl]sulfanylphenyl]phenyl]sulfanylphenyl]-phenylmethylidene]oxidanium hexafluorophosphate |
|---|---|
| PubChem CID | 139989865 |
| Molecular Formula | C33H24F9O2PS2 |
| Molecular Weight | 718.64 g/mol |
| Exact Mass | 718.08 |
| IUPAC Name | [[3-[4-[5-methoxy-2-[4-(trifluoromethyl)phenyl]sulfanylphenyl]phenyl]sulfanylphenyl]-phenylmethylidene]oxidanium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.[H]/[O+]=C(\c1ccccc1)c1cccc(Sc2ccc(-c3cc(OC)ccc3Sc3ccc(C(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C33H23F3O2S2.F6P/c1-38-26-14-19-31(40-28-17-12-25(13-18-28)33(34,35)36)30(21-26)22-10-15-27(16-11-22)39-29-9-5-8-24(20-29)32(37)23-6-3-2-4-7-23;1-7(2,3,4,5)6/h2-21H,1H3;/q;-1/p+1 |
| InChIKey | DLKDHDVTWAMLGE-UHFFFAOYSA-O |
| XLogP | 13.01 |
| TPSA | 30.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.64 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|