C37H24F12O5S3 — CID 139989844
[[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139989844) has the molecular formula C37H24F12O5S3 and a molecular weight of 872.77 g/mol. Its IUPAC name is [[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139989844 |
| Molecular Formula | C37H24F12O5S3 |
| Molecular Weight | 872.77 g/mol |
| Exact Mass | 872.06 |
| IUPAC Name | [[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COc1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccc(Sc3ccccc3C(=O)c3ccccc3)cc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C37H24F12O5S3/c1-53-25-13-19-28(20-14-25)56(27-17-11-24(12-18-27)33(38,39)40,54-57(51,52)37(48,49)35(43,44)34(41,42)36(45,46)47)29-21-15-26(16-22-29)55-31-10-6-5-9-30(31)32(50)23-7-3-2-4-8-23/h2-22H,1H3 |
| InChIKey | ZXJDGQUBCXFENI-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.77 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|