C33H22F4O4S — CID 58690157
[4-(4-methylphenyl)phenyl]-[4-[4-(2,3,5,6-tetrafluoro-4-methylphenyl)sulfonylphenoxy]phenyl]methanone (PubChem CID 58690157) has the molecular formula C33H22F4O4S and a molecular weight of 590.59 g/mol. Its IUPAC name is [4-(4-methylphenyl)phenyl]-[4-[4-(2,3,5,6-tetrafluoro-4-methylphenyl)sulfonylphenoxy]phenyl]methanone.
| Compound Name | [4-(4-methylphenyl)phenyl]-[4-[4-(2,3,5,6-tetrafluoro-4-methylphenyl)sulfonylphenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 58690157 |
| Molecular Formula | C33H22F4O4S |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | [4-(4-methylphenyl)phenyl]-[4-[4-(2,3,5,6-tetrafluoro-4-methylphenyl)sulfonylphenoxy]phenyl]methanone |
| SMILES | Cc1ccc(-c2ccc(C(=O)c3ccc(Oc4ccc(S(=O)(=O)c5c(F)c(F)c(C)c(F)c5F)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H22F4O4S/c1-19-3-5-21(6-4-19)22-7-9-23(10-8-22)32(38)24-11-13-25(14-12-24)41-26-15-17-27(18-16-26)42(39,40)33-30(36)28(34)20(2)29(35)31(33)37/h3-18H,1-2H3 |
| InChIKey | JYTKKZLPUSUHDY-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|