C39H26F6O5S3 — CID 139989848
[[4-(2-benzoyl-3-fluorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate (PubChem CID 139989848) has the molecular formula C39H26F6O5S3 and a molecular weight of 784.82 g/mol. Its IUPAC name is [[4-(2-benzoyl-3-fluorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate.
| Compound Name | [[4-(2-benzoyl-3-fluorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139989848 |
| Molecular Formula | C39H26F6O5S3 |
| Molecular Weight | 784.82 g/mol |
| Exact Mass | 784.08 |
| IUPAC Name | [[4-(2-benzoyl-3-fluorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(S(OS(=O)(=O)c2ccc(C)cc2)(c2ccc(Sc3cccc(F)c3C(=O)c3ccccc3)cc2)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C39H26F6O5S3/c1-23-11-17-29(18-12-23)53(47,48)50-52(27-19-13-25(49-2)14-20-27,39-36(44)34(42)33(41)35(43)37(39)45)28-21-15-26(16-22-28)51-31-10-6-9-30(40)32(31)38(46)24-7-4-3-5-8-24/h3-22H,1-2H3 |
| InChIKey | JMISZTXWPNNVLT-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.82 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|