C24H18O4S2 — CID 42600204
2,3-bis[(3-methoxyphenyl)sulfanyl]naphthalene-1,4-dione (PubChem CID 42600204) has the molecular formula C24H18O4S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2,3-bis[(3-methoxyphenyl)sulfanyl]naphthalene-1,4-dione.
| Compound Name | 2,3-bis[(3-methoxyphenyl)sulfanyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 42600204 |
| Molecular Formula | C24H18O4S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 2,3-bis[(3-methoxyphenyl)sulfanyl]naphthalene-1,4-dione |
| SMILES | COc1cccc(SC2=C(Sc3cccc(OC)c3)C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C24H18O4S2/c1-27-15-7-5-9-17(13-15)29-23-21(25)19-11-3-4-12-20(19)22(26)24(23)30-18-10-6-8-16(14-18)28-2/h3-14H,1-2H3 |
| InChIKey | ADQDMFBIHUXFLT-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|