C10H11NS — CID 142049337
N-[(1E)-2-thiophen-3-ylbuta-1,3-dienyl]ethanimine (PubChem CID 142049337) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is N-[(1E)-2-thiophen-3-ylbuta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1E)-2-thiophen-3-ylbuta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 142049337 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | N-[(1E)-2-thiophen-3-ylbuta-1,3-dienyl]ethanimine |
| SMILES | C=C/C(=C\N=C\C)c1ccsc1 |
| InChI | InChI=1S/C10H11NS/c1-3-9(7-11-4-2)10-5-6-12-8-10/h3-8H,1H2,2H3/b9-7+,11-4+ |
| InChIKey | LHPNWMOVEHZFEK-KLGRRIHOSA-N |
| XLogP | 3.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|