C13H20S — CID 143157871
3-buta-1,3-dien-2-ylthiophene;ethane;prop-1-ene (PubChem CID 143157871) has the molecular formula C13H20S and a molecular weight of 208.37 g/mol. Its IUPAC name is 3-buta-1,3-dien-2-ylthiophene;ethane;prop-1-ene.
| Compound Name | 3-buta-1,3-dien-2-ylthiophene;ethane;prop-1-ene |
|---|---|
| PubChem CID | 143157871 |
| Molecular Formula | C13H20S |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 3-buta-1,3-dien-2-ylthiophene;ethane;prop-1-ene |
| SMILES | C=CC.C=CC(=C)c1ccsc1.CC |
| InChI | InChI=1S/C8H8S.C3H6.C2H6/c1-3-7(2)8-4-5-9-6-8;1-3-2;1-2/h3-6H,1-2H2;3H,1H2,2H3;1-2H3 |
| InChIKey | ZAQJFZVRJINNHO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|