About N-methylacetamide;N-methylprop-1-en-2-amine
N-methylacetamide;N-methylprop-1-en-2-amine (PubChem CID 142049916) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is N-methylacetamide;N-methylprop-1-en-2-amine.
Molecular Properties
| Compound Name | N-methylacetamide;N-methylprop-1-en-2-amine |
| PubChem CID | 142049916 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | N-methylacetamide;N-methylprop-1-en-2-amine |
| SMILES | C=C(C)NC.CNC(C)=O |
| InChI | InChI=1S/C4H9N.C3H7NO/c1-4(2)5-3;1-3(5)4-2/h5H,1H2,2-3H3;1-2H3,(H,4,5) |
| InChIKey | DBBVHMGPJGFJLU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methylacetamide;N-methylprop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylacetamide;N-methylprop-1-en-2-amine?
The IUPAC name of N-methylacetamide;N-methylprop-1-en-2-amine (CID 142049916) is N-methylacetamide;N-methylprop-1-en-2-amine.
What is the SMILES notation for N-methylacetamide;N-methylprop-1-en-2-amine?
The canonical SMILES for N-methylacetamide;N-methylprop-1-en-2-amine is C=C(C)NC.CNC(C)=O.
What is the InChIKey of N-methylacetamide;N-methylprop-1-en-2-amine?
The InChIKey is DBBVHMGPJGFJLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N.C3H7NO/c1-4(2)5-3;1-3(5)4-2/h5H,1H2,2-3H3;1-2H3,(H,4,5).
What are the key properties of N-methylacetamide;N-methylprop-1-en-2-amine?
N-methylacetamide;N-methylprop-1-en-2-amine has a molecular weight of 144.22 g/mol, XLogP of 0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylacetamide;N-methylprop-1-en-2-amine is sourced from PubChem (CID 142049916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).