About but-1-en-2-amine;N-methylpropanamide
but-1-en-2-amine;N-methylpropanamide (PubChem CID 143544208) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is but-1-en-2-amine;N-methylpropanamide.
Molecular Properties
| Compound Name | but-1-en-2-amine;N-methylpropanamide |
| PubChem CID | 143544208 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | but-1-en-2-amine;N-methylpropanamide |
| SMILES | C=C(N)CC.CCC(=O)NC |
| InChI | InChI=1S/C4H9NO.C4H9N/c1-3-4(6)5-2;1-3-4(2)5/h3H2,1-2H3,(H,5,6);2-3,5H2,1H3 |
| InChIKey | LLORRIMLAYCALK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze but-1-en-2-amine;N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-en-2-amine;N-methylpropanamide?
The IUPAC name of but-1-en-2-amine;N-methylpropanamide (CID 143544208) is but-1-en-2-amine;N-methylpropanamide.
What is the SMILES notation for but-1-en-2-amine;N-methylpropanamide?
The canonical SMILES for but-1-en-2-amine;N-methylpropanamide is C=C(N)CC.CCC(=O)NC.
What is the InChIKey of but-1-en-2-amine;N-methylpropanamide?
The InChIKey is LLORRIMLAYCALK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C4H9N/c1-3-4(6)5-2;1-3-4(2)5/h3H2,1-2H3,(H,5,6);2-3,5H2,1H3.
What are the key properties of but-1-en-2-amine;N-methylpropanamide?
but-1-en-2-amine;N-methylpropanamide has a molecular weight of 158.24 g/mol, XLogP of 1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-en-2-amine;N-methylpropanamide is sourced from PubChem (CID 143544208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).