About 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane
2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane (PubChem CID 142050733) has the molecular formula C8H17N3
and a molecular weight of 155.24 g/mol. Its IUPAC name is 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane.
Molecular Properties
| Compound Name | 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane |
| PubChem CID | 142050733 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane |
| SMILES | C=N/C(CN)=N/C(=C)C.CC |
| InChI | InChI=1S/C6H11N3.C2H6/c1-5(2)9-6(4-7)8-3;1-2/h1,3-4,7H2,2H3;1-2H3/b9-6+; |
| InChIKey | HMNTTXPIMLVMCW-MLBSPLJJSA-N |
| XLogP | 1.60 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane?
The IUPAC name of 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane (CID 142050733) is 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane.
What is the SMILES notation for 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane?
The canonical SMILES for 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane is C=N/C(CN)=N/C(=C)C.CC.
What is the InChIKey of 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane?
The InChIKey is HMNTTXPIMLVMCW-MLBSPLJJSA-N. The full InChI is InChI=1S/C6H11N3.C2H6/c1-5(2)9-6(4-7)8-3;1-2/h1,3-4,7H2,2H3;1-2H3/b9-6+;.
What are the key properties of 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane?
2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane has a molecular weight of 155.24 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-methylidene-N'-prop-1-en-2-ylethanimidamide;ethane is sourced from PubChem (CID 142050733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).