About ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide
ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide (PubChem CID 153331511) has the molecular formula C10H23N3
and a molecular weight of 185.31 g/mol. Its IUPAC name is ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide.
Molecular Properties
| Compound Name | ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide |
| PubChem CID | 153331511 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide |
| SMILES | C=C(C)/N=C(N)/C=N/C.CC.CC |
| InChI | InChI=1S/C6H11N3.2C2H6/c1-5(2)9-6(7)4-8-3;2*1-2/h4H,1H2,2-3H3,(H2,7,9);2*1-2H3/b8-4+;; |
| InChIKey | KULJXCMVAHPAEQ-ZDTICIBISA-N |
| XLogP | 2.63 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide?
The IUPAC name of ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide (CID 153331511) is ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide.
What is the SMILES notation for ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide?
The canonical SMILES for ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide is C=C(C)/N=C(N)/C=N/C.CC.CC.
What is the InChIKey of ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide?
The InChIKey is KULJXCMVAHPAEQ-ZDTICIBISA-N. The full InChI is InChI=1S/C6H11N3.2C2H6/c1-5(2)9-6(7)4-8-3;2*1-2/h4H,1H2,2-3H3,(H2,7,9);2*1-2H3/b8-4+;;.
What are the key properties of ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide?
ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide has a molecular weight of 185.31 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylimino-N'-prop-1-en-2-ylethanimidamide is sourced from PubChem (CID 153331511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).