C10H20N2 — CID 142050923
(Z)-N,N,3-trimethyl-2-(methyliminomethyl)pent-2-en-1-amine (PubChem CID 142050923) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (Z)-N,N,3-trimethyl-2-(methyliminomethyl)pent-2-en-1-amine.
| Compound Name | (Z)-N,N,3-trimethyl-2-(methyliminomethyl)pent-2-en-1-amine |
|---|---|
| PubChem CID | 142050923 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (Z)-N,N,3-trimethyl-2-(methyliminomethyl)pent-2-en-1-amine |
| SMILES | CC/C(C)=C(\C=N\C)CN(C)C |
| InChI | InChI=1S/C10H20N2/c1-6-9(2)10(7-11-3)8-12(4)5/h7H,6,8H2,1-5H3/b10-9+,11-7+ |
| InChIKey | HLQOKZHNFUOWDV-FVSXOECNSA-N |
| XLogP | 1.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|