About 2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine
2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine (PubChem CID 142206786) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine.
Analyze 2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine (CID 142206786) is 2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine is CN(C)CCC1=CCCN=C1.
What is the InChIKey of 2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine?
The InChIKey is XZQIQYVSNZEMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-11(2)7-5-9-4-3-6-10-8-9/h4,8H,3,5-7H2,1-2H3.
What are the key properties of 2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine?
2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine has a molecular weight of 152.24 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydropyridin-5-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 142206786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).