C11H20N2 — CID 90893148
5-ethyl-9-methyl-3,4,6,7-tetrahydro-2H-1,5-diazecine (PubChem CID 90893148) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 5-ethyl-9-methyl-3,4,6,7-tetrahydro-2H-1,5-diazecine.
| Compound Name | 5-ethyl-9-methyl-3,4,6,7-tetrahydro-2H-1,5-diazecine |
|---|---|
| PubChem CID | 90893148 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 5-ethyl-9-methyl-3,4,6,7-tetrahydro-2H-1,5-diazecine |
| SMILES | CCN1CCC=C(C)/C=N/CCC1 |
| InChI | InChI=1S/C11H20N2/c1-3-13-8-4-6-11(2)10-12-7-5-9-13/h6,10H,3-5,7-9H2,1-2H3/b11-6?,12-10+ |
| InChIKey | GBUBNGRXZATVAN-YMNKRAHHSA-N |
| XLogP | 2.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |