About (3-methylphenyl)methanamine;4-methylpyridine
(3-methylphenyl)methanamine;4-methylpyridine (PubChem CID 142051199) has the molecular formula C14H18N2
and a molecular weight of 214.31 g/mol. Its IUPAC name is (3-methylphenyl)methanamine;4-methylpyridine.
Molecular Properties
| Compound Name | (3-methylphenyl)methanamine;4-methylpyridine |
| PubChem CID | 142051199 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (3-methylphenyl)methanamine;4-methylpyridine |
| SMILES | Cc1cccc(CN)c1.Cc1ccncc1 |
| InChI | InChI=1S/C8H11N.C6H7N/c1-7-3-2-4-8(5-7)6-9;1-6-2-4-7-5-3-6/h2-5H,6,9H2,1H3;2-5H,1H3 |
| InChIKey | KKZRTAYGUZREII-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-methylphenyl)methanamine;4-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl)methanamine;4-methylpyridine?
The IUPAC name of (3-methylphenyl)methanamine;4-methylpyridine (CID 142051199) is (3-methylphenyl)methanamine;4-methylpyridine.
What is the SMILES notation for (3-methylphenyl)methanamine;4-methylpyridine?
The canonical SMILES for (3-methylphenyl)methanamine;4-methylpyridine is Cc1cccc(CN)c1.Cc1ccncc1.
What is the InChIKey of (3-methylphenyl)methanamine;4-methylpyridine?
The InChIKey is KKZRTAYGUZREII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C6H7N/c1-7-3-2-4-8(5-7)6-9;1-6-2-4-7-5-3-6/h2-5H,6,9H2,1H3;2-5H,1H3.
What are the key properties of (3-methylphenyl)methanamine;4-methylpyridine?
(3-methylphenyl)methanamine;4-methylpyridine has a molecular weight of 214.31 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl)methanamine;4-methylpyridine is sourced from PubChem (CID 142051199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).