C23H23N5O3 — CID 142051419
2-[[4-[(E)-N'-hydroxycarbamimidoyl]benzoyl]amino]-3,5-dimethyl-N-(5-methyl-2-pyridinyl)benzamide (PubChem CID 142051419) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[[4-[(E)-N'-hydroxycarbamimidoyl]benzoyl]amino]-3,5-dimethyl-N-(5-methyl-2-pyridinyl)benzamide.
| Compound Name | 2-[[4-[(E)-N'-hydroxycarbamimidoyl]benzoyl]amino]-3,5-dimethyl-N-(5-methyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 142051419 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[[4-[(E)-N'-hydroxycarbamimidoyl]benzoyl]amino]-3,5-dimethyl-N-(5-methyl-2-pyridinyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C)cc(C)c2NC(=O)c2ccc(/C(N)=N\O)cc2)nc1 |
| InChI | InChI=1S/C23H23N5O3/c1-13-4-9-19(25-12-13)26-23(30)18-11-14(2)10-15(3)20(18)27-22(29)17-7-5-16(6-8-17)21(24)28-31/h4-12,31H,1-3H3,(H2,24,28)(H,27,29)(H,25,26,30) |
| InChIKey | WAVSCTPKPLXMNL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|