C5H7F3N2 — CID 142052036
(Z)-1,1,1-trifluoro-4-imino-3-methylbut-2-en-2-amine (PubChem CID 142052036) has the molecular formula C5H7F3N2 and a molecular weight of 152.12 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-imino-3-methylbut-2-en-2-amine.
| Compound Name | (Z)-1,1,1-trifluoro-4-imino-3-methylbut-2-en-2-amine |
|---|---|
| PubChem CID | 142052036 |
| Molecular Formula | C5H7F3N2 |
| Molecular Weight | 152.12 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-imino-3-methylbut-2-en-2-amine |
| SMILES | [H]/N=C/C(C)=C(\N)C(F)(F)F |
| InChI | InChI=1S/C5H7F3N2/c1-3(2-9)4(10)5(6,7)8/h2,9H,10H2,1H3/b4-3-,9-2+ |
| InChIKey | SSNHHUZSSKQIGA-FJWPBBPESA-N |
| XLogP | 1.43 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.12 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|