C6H8F3N — CID 155581977
(E)-4,4,4-trifluoro-2,3-dimethylbut-2-en-1-imine (PubChem CID 155581977) has the molecular formula C6H8F3N and a molecular weight of 151.13 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-2,3-dimethylbut-2-en-1-imine.
| Compound Name | (E)-4,4,4-trifluoro-2,3-dimethylbut-2-en-1-imine |
|---|---|
| PubChem CID | 155581977 |
| Molecular Formula | C6H8F3N |
| Molecular Weight | 151.13 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (E)-4,4,4-trifluoro-2,3-dimethylbut-2-en-1-imine |
| SMILES | [H]/N=C/C(C)=C(\C)C(F)(F)F |
| InChI | InChI=1S/C6H8F3N/c1-4(3-10)5(2)6(7,8)9/h3,10H,1-2H3/b5-4+,10-3+ |
| InChIKey | SRJKRDBQDGQCJL-RUQOPNIZSA-N |
| XLogP | 2.53 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.13 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|