C25H29NO3 — CID 142053581
3-[4-[2-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]cyclohexa-1,3-dien-1-yl]-2-methylpropanoic acid (PubChem CID 142053581) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 3-[4-[2-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]cyclohexa-1,3-dien-1-yl]-2-methylpropanoic acid.
| Compound Name | 3-[4-[2-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]cyclohexa-1,3-dien-1-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 142053581 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 3-[4-[2-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]cyclohexa-1,3-dien-1-yl]-2-methylpropanoic acid |
| SMILES | CC(CC1=CC=C(c2ccccc2CNCCc2ccc(O)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C25H29NO3/c1-18(25(28)29)16-20-6-10-21(11-7-20)24-5-3-2-4-22(24)17-26-15-14-19-8-12-23(27)13-9-19/h2-6,8-10,12-13,18,26-27H,7,11,14-17H2,1H3,(H,28,29) |
| InChIKey | MYTDEKCYGGTDMV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|