C27H27NO3 — CID 70613137
3-[4-[2-[[2-(9H-fluoren-1-yl)acetyl]amino]ethyl]phenyl]-2-methylpropanoic acid (PubChem CID 70613137) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-[4-[2-[[2-(9H-fluoren-1-yl)acetyl]amino]ethyl]phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[4-[2-[[2-(9H-fluoren-1-yl)acetyl]amino]ethyl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 70613137 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 3-[4-[2-[[2-(9H-fluoren-1-yl)acetyl]amino]ethyl]phenyl]-2-methylpropanoic acid |
| SMILES | CC(Cc1ccc(CCNC(=O)Cc2cccc3c2Cc2ccccc2-3)cc1)C(=O)O |
| InChI | InChI=1S/C27H27NO3/c1-18(27(30)31)15-20-11-9-19(10-12-20)13-14-28-26(29)17-22-6-4-8-24-23-7-3-2-5-21(23)16-25(22)24/h2-12,18H,13-17H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | GTBJAWYPOAPANB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |