About N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane
N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane (PubChem CID 142053778) has the molecular formula C10H18ClN
and a molecular weight of 187.71 g/mol. Its IUPAC name is N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane.
Molecular Properties
| Compound Name | N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane |
| PubChem CID | 142053778 |
| Molecular Formula | C10H18ClN |
| Molecular Weight | 187.71 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane |
| SMILES | C=NC(=C(C)C)/C(Cl)=C\C.CC |
| InChI | InChI=1S/C8H12ClN.C2H6/c1-5-7(9)8(10-4)6(2)3;1-2/h5H,4H2,1-3H3;1-2H3/b7-5+; |
| InChIKey | MHQIDKKXFNTMSY-GZOLSCHFSA-N |
| XLogP | 4.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane?
The IUPAC name of N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane (CID 142053778) is N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane.
What is the SMILES notation for N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane?
The canonical SMILES for N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane is C=NC(=C(C)C)/C(Cl)=C\C.CC.
What is the InChIKey of N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane?
The InChIKey is MHQIDKKXFNTMSY-GZOLSCHFSA-N. The full InChI is InChI=1S/C8H12ClN.C2H6/c1-5-7(9)8(10-4)6(2)3;1-2/h5H,4H2,1-3H3;1-2H3/b7-5+;.
What are the key properties of N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane?
N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane has a molecular weight of 187.71 g/mol, XLogP of 4.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4E)-4-chloro-2-methylhexa-2,4-dien-3-yl]methanimine;ethane is sourced from PubChem (CID 142053778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).