C13H24ClN — CID 144875619
N-[(2E)-3-chloro-5-methylhexa-2,4-dien-2-yl]methanimine;ethene;propane (PubChem CID 144875619) has the molecular formula C13H24ClN and a molecular weight of 229.79 g/mol. Its IUPAC name is N-[(2E)-3-chloro-5-methylhexa-2,4-dien-2-yl]methanimine;ethene;propane.
| Compound Name | N-[(2E)-3-chloro-5-methylhexa-2,4-dien-2-yl]methanimine;ethene;propane |
|---|---|
| PubChem CID | 144875619 |
| Molecular Formula | C13H24ClN |
| Molecular Weight | 229.79 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | N-[(2E)-3-chloro-5-methylhexa-2,4-dien-2-yl]methanimine;ethene;propane |
| SMILES | C=C.C=N/C(C)=C(/Cl)C=C(C)C.CCC |
| InChI | InChI=1S/C8H12ClN.C3H8.C2H4/c1-6(2)5-8(9)7(3)10-4;1-3-2;1-2/h5H,4H2,1-3H3;3H2,1-2H3;1-2H2/b8-7+;; |
| InChIKey | OJOAEGKSDMLPRB-MIIBGCIDSA-N |
| XLogP | 5.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.79 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|