C8H9ClF3N — CID 142010067
N-[(2E,4E)-3-chloro-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]methanimine (PubChem CID 142010067) has the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. Its IUPAC name is N-[(2E,4E)-3-chloro-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]methanimine.
| Compound Name | N-[(2E,4E)-3-chloro-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 142010067 |
| Molecular Formula | C8H9ClF3N |
| Molecular Weight | 211.61 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | N-[(2E,4E)-3-chloro-6,6,6-trifluoro-5-methylhexa-2,4-dien-2-yl]methanimine |
| SMILES | C=N/C(C)=C(Cl)\C=C(/C)C(F)(F)F |
| InChI | InChI=1S/C8H9ClF3N/c1-5(8(10,11)12)4-7(9)6(2)13-3/h4H,3H2,1-2H3/b5-4+,7-6+ |
| InChIKey | JADJJYYIUQYGFS-YTXTXJHMSA-N |
| XLogP | 3.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|