C7H8ClF2N — CID 167239958
N-[(2E,4E)-1-chloro-3,5-difluorohexa-2,4-dien-2-yl]methanimine (PubChem CID 167239958) has the molecular formula C7H8ClF2N and a molecular weight of 179.60 g/mol. Its IUPAC name is N-[(2E,4E)-1-chloro-3,5-difluorohexa-2,4-dien-2-yl]methanimine.
| Compound Name | N-[(2E,4E)-1-chloro-3,5-difluorohexa-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 167239958 |
| Molecular Formula | C7H8ClF2N |
| Molecular Weight | 179.60 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | N-[(2E,4E)-1-chloro-3,5-difluorohexa-2,4-dien-2-yl]methanimine |
| SMILES | C=N/C(CCl)=C(F)\C=C(/C)F |
| InChI | InChI=1S/C7H8ClF2N/c1-5(9)3-6(10)7(4-8)11-2/h3H,2,4H2,1H3/b5-3+,7-6+ |
| InChIKey | YQUGWRBXKRDOBS-TWTPFVCWSA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|