C9H14ClN — CID 139372683
N-[(3E)-4-chloro-6-methylhepta-3,5-dien-3-yl]methanimine (PubChem CID 139372683) has the molecular formula C9H14ClN and a molecular weight of 171.67 g/mol. Its IUPAC name is N-[(3E)-4-chloro-6-methylhepta-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3E)-4-chloro-6-methylhepta-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 139372683 |
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.67 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | N-[(3E)-4-chloro-6-methylhepta-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(CC)=C(/Cl)C=C(C)C |
| InChI | InChI=1S/C9H14ClN/c1-5-9(11-4)8(10)6-7(2)3/h6H,4-5H2,1-3H3/b9-8+ |
| InChIKey | OXBMAEVLMOZLAF-CMDGGOBGSA-N |
| XLogP | 3.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.67 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|