C11H11N — CID 123203158
N-(2-prop-1-enylcyclohepta-1,3,4,6-tetraen-1-yl)methanimine (PubChem CID 123203158) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is N-(2-prop-1-enylcyclohepta-1,3,4,6-tetraen-1-yl)methanimine.
| Compound Name | N-(2-prop-1-enylcyclohepta-1,3,4,6-tetraen-1-yl)methanimine |
|---|---|
| PubChem CID | 123203158 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | N-(2-prop-1-enylcyclohepta-1,3,4,6-tetraen-1-yl)methanimine |
| SMILES | C=NC1=C(C=CC)C=C=CC=C1 |
| InChI | InChI=1S/C11H11N/c1-3-7-10-8-5-4-6-9-11(10)12-2/h3-4,6-9H,2H2,1H3 |
| InChIKey | NVCYVYPUEWECGV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|