C7H11N — CID 123428702
N-(4-methylpenta-2,4-dien-2-yl)methanimine (PubChem CID 123428702) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is N-(4-methylpenta-2,4-dien-2-yl)methanimine.
| Compound Name | N-(4-methylpenta-2,4-dien-2-yl)methanimine |
|---|---|
| PubChem CID | 123428702 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | N-(4-methylpenta-2,4-dien-2-yl)methanimine |
| SMILES | C=NC(C)=CC(=C)C |
| InChI | InChI=1S/C7H11N/c1-6(2)5-7(3)8-4/h5H,1,4H2,2-3H3 |
| InChIKey | PXYPVWXJNXKVME-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|