C27H44O4S2 — CID 142053802
(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2',2'-dioxospiro[2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,4'-oxadithietane]-3-ol (PubChem CID 142053802) has the molecular formula C27H44O4S2 and a molecular weight of 496.78 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2',2'-dioxospiro[2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,4'-oxadithietane]-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2',2'-dioxospiro[2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,4'-oxadithietane]-3-ol |
|---|---|
| PubChem CID | 142053802 |
| Molecular Formula | C27H44O4S2 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2',2'-dioxospiro[2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-1,4'-oxadithietane]-3-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](O)CC5(OS(=O)(=O)S5)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44O4S2/c1-17(2)7-6-8-18(3)22-11-12-23-21-10-9-19-15-20(28)16-27(31-33(29,30)32-27)26(19,5)24(21)13-14-25(22,23)4/h9,17-18,20-24,28H,6-8,10-16H2,1-5H3/t18-,20+,21+,22-,23+,24+,25-,26+,27?/m1/s1 |
| InChIKey | ZNVLQVYYLJJMIP-VOWXPDBQSA-N |
| XLogP | 6.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|