C27H48O7P2 — CID 174902038
[(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1-phosphono-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]phosphonic acid (PubChem CID 174902038) has the molecular formula C27H48O7P2 and a molecular weight of 546.62 g/mol. Its IUPAC name is [(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1-phosphono-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]phosphonic acid.
| Compound Name | [(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1-phosphono-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 174902038 |
| Molecular Formula | C27H48O7P2 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | [(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1-phosphono-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-yl]phosphonic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC(P(=O)(O)O)(P(=O)(O)O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H48O7P2/c1-17(2)7-6-8-18(3)22-11-12-23-21-10-9-19-15-20(28)16-27(35(29,30)31,36(32,33)34)26(19,5)24(21)13-14-25(22,23)4/h9,17-18,20-24,28H,6-8,10-16H2,1-5H3,(H2,29,30,31)(H2,32,33,34)/t18-,20-,21+,22-,23+,24+,25-,26+/m1/s1 |
| InChIKey | CDQFTBNOIRUDAR-OXSUAPESSA-N |
| XLogP | 6.05 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|