C31H48O — CID 142054722
(2R)-3-cyclobutyl-2-ethyl-3-(4-methylphenyl)octanal;ethane;1,4-xylene (PubChem CID 142054722) has the molecular formula C31H48O and a molecular weight of 436.72 g/mol. Its IUPAC name is (2R)-3-cyclobutyl-2-ethyl-3-(4-methylphenyl)octanal;ethane;1,4-xylene.
| Compound Name | (2R)-3-cyclobutyl-2-ethyl-3-(4-methylphenyl)octanal;ethane;1,4-xylene |
|---|---|
| PubChem CID | 142054722 |
| Molecular Formula | C31H48O |
| Molecular Weight | 436.72 g/mol |
| Exact Mass | 436.37 |
| IUPAC Name | (2R)-3-cyclobutyl-2-ethyl-3-(4-methylphenyl)octanal;ethane;1,4-xylene |
| SMILES | CC.CCCCCC(c1ccc(C)cc1)(C1CCC1)[C@H](C=O)CC.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C21H32O.C8H10.C2H6/c1-4-6-7-15-21(18(5-2)16-22,19-9-8-10-19)20-13-11-17(3)12-14-20;1-7-3-5-8(2)6-4-7;1-2/h11-14,16,18-19H,4-10,15H2,1-3H3;3-6H,1-2H3;1-2H3/t18-,21?;;/m0../s1 |
| InChIKey | NLGZQJSKGARSNS-SANRYGKWSA-N |
| XLogP | 9.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.72 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|