C24H22BrN7 — CID 142056669
2-N-[4-(benzylamino)-3-methanimidoylphenyl]-4-N-(3-bromophenyl)-2-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 142056669) has the molecular formula C24H22BrN7 and a molecular weight of 488.39 g/mol. Its IUPAC name is 2-N-[4-(benzylamino)-3-methanimidoylphenyl]-4-N-(3-bromophenyl)-2-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[4-(benzylamino)-3-methanimidoylphenyl]-4-N-(3-bromophenyl)-2-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 142056669 |
| Molecular Formula | C24H22BrN7 |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 2-N-[4-(benzylamino)-3-methanimidoylphenyl]-4-N-(3-bromophenyl)-2-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | [H]/N=C/c1cc(N(C)c2ncnc(Nc3cccc(Br)c3)n2)ccc1NCc1ccccc1 |
| InChI | InChI=1S/C24H22BrN7/c1-32(24-29-16-28-23(31-24)30-20-9-5-8-19(25)13-20)21-10-11-22(18(12-21)14-26)27-15-17-6-3-2-4-7-17/h2-14,16,26-27H,15H2,1H3,(H,28,29,30,31)/b26-14+ |
| InChIKey | VDOQFPCRPJULDB-VULFUBBASA-N |
| XLogP | 5.76 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|