C16H14ClN5O — CID 23536028
4-[[4-(3-chloro-N-methylanilino)-1,3,5-triazin-2-yl]amino]phenol (PubChem CID 23536028) has the molecular formula C16H14ClN5O and a molecular weight of 327.78 g/mol. Its IUPAC name is 4-[[4-(3-chloro-N-methylanilino)-1,3,5-triazin-2-yl]amino]phenol.
| Compound Name | 4-[[4-(3-chloro-N-methylanilino)-1,3,5-triazin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 23536028 |
| Molecular Formula | C16H14ClN5O |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 4-[[4-(3-chloro-N-methylanilino)-1,3,5-triazin-2-yl]amino]phenol |
| SMILES | CN(c1cccc(Cl)c1)c1ncnc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C16H14ClN5O/c1-22(13-4-2-3-11(17)9-13)16-19-10-18-15(21-16)20-12-5-7-14(23)8-6-12/h2-10,23H,1H3,(H,18,19,20,21) |
| InChIKey | AKWMOIDHMBZBDM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|