C16H14ClFN5O3+ — CID 142056927
[5-[[4-(3-chloro-4-fluoro-N-methylanilino)-1,3,5-triazin-2-yl]amino]-2,3-dihydroxyphenyl]oxidanium (PubChem CID 142056927) has the molecular formula C16H14ClFN5O3+ and a molecular weight of 378.77 g/mol. Its IUPAC name is [5-[[4-(3-chloro-4-fluoro-N-methylanilino)-1,3,5-triazin-2-yl]amino]-2,3-dihydroxyphenyl]oxidanium.
| Compound Name | [5-[[4-(3-chloro-4-fluoro-N-methylanilino)-1,3,5-triazin-2-yl]amino]-2,3-dihydroxyphenyl]oxidanium |
|---|---|
| PubChem CID | 142056927 |
| Molecular Formula | C16H14ClFN5O3+ |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | [5-[[4-(3-chloro-4-fluoro-N-methylanilino)-1,3,5-triazin-2-yl]amino]-2,3-dihydroxyphenyl]oxidanium |
| SMILES | CN(c1ccc(F)c(Cl)c1)c1ncnc(Nc2cc(O)c(O)c([OH2+])c2)n1 |
| InChI | InChI=1S/C16H13ClFN5O3/c1-23(9-2-3-11(18)10(17)6-9)16-20-7-19-15(22-16)21-8-4-12(24)14(26)13(25)5-8/h2-7,24-26H,1H3,(H,19,20,21,22)/p+1 |
| InChIKey | HVVMHUNPVGGOIS-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|