C20H17ClN6O — CID 91449820
N-[3-[[4-(3-chloro-N-methylanilino)-1,3,5-triazin-2-yl]amino]phenyl]but-2-ynamide (PubChem CID 91449820) has the molecular formula C20H17ClN6O and a molecular weight of 392.85 g/mol. Its IUPAC name is N-[3-[[4-(3-chloro-N-methylanilino)-1,3,5-triazin-2-yl]amino]phenyl]but-2-ynamide.
| Compound Name | N-[3-[[4-(3-chloro-N-methylanilino)-1,3,5-triazin-2-yl]amino]phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 91449820 |
| Molecular Formula | C20H17ClN6O |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[3-[[4-(3-chloro-N-methylanilino)-1,3,5-triazin-2-yl]amino]phenyl]but-2-ynamide |
| SMILES | CC#CC(=O)Nc1cccc(Nc2ncnc(N(C)c3cccc(Cl)c3)n2)c1 |
| InChI | InChI=1S/C20H17ClN6O/c1-3-6-18(28)24-15-8-5-9-16(12-15)25-19-22-13-23-20(26-19)27(2)17-10-4-7-14(21)11-17/h4-5,7-13H,1-2H3,(H,24,28)(H,22,23,25,26) |
| InChIKey | FUKKMHPWDOYJQR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|