C26H27N3O7S — CID 142058242
benzyl 2-[[(2R)-2-(benzylsulfonylamino)-3-(4-nitrophenyl)propanoyl]-methylamino]acetate (PubChem CID 142058242) has the molecular formula C26H27N3O7S and a molecular weight of 525.58 g/mol. Its IUPAC name is benzyl 2-[[(2R)-2-(benzylsulfonylamino)-3-(4-nitrophenyl)propanoyl]-methylamino]acetate.
| Compound Name | benzyl 2-[[(2R)-2-(benzylsulfonylamino)-3-(4-nitrophenyl)propanoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 142058242 |
| Molecular Formula | C26H27N3O7S |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | benzyl 2-[[(2R)-2-(benzylsulfonylamino)-3-(4-nitrophenyl)propanoyl]-methylamino]acetate |
| SMILES | CN(CC(=O)OCc1ccccc1)C(=O)[C@@H](Cc1ccc([N+](=O)[O-])cc1)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H27N3O7S/c1-28(17-25(30)36-18-21-8-4-2-5-9-21)26(31)24(16-20-12-14-23(15-13-20)29(32)33)27-37(34,35)19-22-10-6-3-7-11-22/h2-15,24,27H,16-19H2,1H3/t24-/m1/s1 |
| InChIKey | NCZHWNMYAWAULA-XMMPIXPASA-N |
| XLogP | 2.83 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|