C16H33F3N2O2 — CID 142058542
tert-butyl N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]carbamate;ethane (PubChem CID 142058542) has the molecular formula C16H33F3N2O2 and a molecular weight of 342.45 g/mol. Its IUPAC name is tert-butyl N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]carbamate;ethane |
|---|---|
| PubChem CID | 142058542 |
| Molecular Formula | C16H33F3N2O2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | tert-butyl N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]carbamate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)NC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H21F3N2O2.2C2H6/c1-11(2,3)19-10(18)16-9-4-6-17(7-5-9)8-12(13,14)15;2*1-2/h9H,4-8H2,1-3H3,(H,16,18);2*1-2H3 |
| InChIKey | SNJFFSKBYXXODA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |